C15H17NO3 — CID 95466052
1-[5-[4-(2-methylpropoxy)phenyl]-1,2-oxazol-4-yl]ethanone (PubChem CID 95466052) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[5-[4-(2-methylpropoxy)phenyl]-1,2-oxazol-4-yl]ethanone.
| Compound Name | 1-[5-[4-(2-methylpropoxy)phenyl]-1,2-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 95466052 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[5-[4-(2-methylpropoxy)phenyl]-1,2-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnoc1-c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C15H17NO3/c1-10(2)9-18-13-6-4-12(5-7-13)15-14(11(3)17)8-16-19-15/h4-8,10H,9H2,1-3H3 |
| InChIKey | IUVSJQOGFYVHEW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |