C14H15NO2S — CID 95467468
2-[(3-ethyl-4-methoxyphenyl)methyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 95467468) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[(3-ethyl-4-methoxyphenyl)methyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[(3-ethyl-4-methoxyphenyl)methyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 95467468 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-[(3-ethyl-4-methoxyphenyl)methyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCc1cc(Cc2ncc(C=O)s2)ccc1OC |
| InChI | InChI=1S/C14H15NO2S/c1-3-11-6-10(4-5-13(11)17-2)7-14-15-8-12(9-16)18-14/h4-6,8-9H,3,7H2,1-2H3 |
| InChIKey | CLDBGZQYRJKNEG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|