3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid

C12H13Cl2NO4 — CID 95534698

IUPAC3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid
SMILESCOCC(=O)N(CCC(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H13Cl2NO4/c1-19-7-11(16)15(5-4-12(17)18)10-3-2-8(13)6-9(10)14/h2-3,6H,4-5,7H2,1H3,(H,17,18)
InChIKeyRHEGFLSHAGRKCB-UHFFFAOYSA-N
MW306.15 g/mol
LogP2.45
Rot. Bonds6

About 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid

3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid (PubChem CID 95534698) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid.

Molecular Properties

Compound Name3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid
PubChem CID95534698
Molecular FormulaC12H13Cl2NO4
Molecular Weight306.15 g/mol
Exact Mass305.02
IUPAC Name3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid
SMILESCOCC(=O)N(CCC(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H13Cl2NO4/c1-19-7-11(16)15(5-4-12(17)18)10-3-2-8(13)6-9(10)14/h2-3,6H,4-5,7H2,1H3,(H,17,18)
InChIKeyRHEGFLSHAGRKCB-UHFFFAOYSA-N
XLogP2.45
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.15
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid?
The IUPAC name of 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid (CID 95534698) is 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid.
What is the SMILES notation for 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid?
The canonical SMILES for 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid is COCC(=O)N(CCC(=O)O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid?
The InChIKey is RHEGFLSHAGRKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO4/c1-19-7-11(16)15(5-4-12(17)18)10-3-2-8(13)6-9(10)14/h2-3,6H,4-5,7H2,1H3,(H,17,18).
What are the key properties of 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid?
3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid has a molecular weight of 306.15 g/mol, XLogP of 2.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dichloro-N-(2-methoxyacetyl)anilino)propanoic acid is sourced from PubChem (CID 95534698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).