C14H14ClN3O2S — CID 95539381
2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 95539381) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95539381 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(N2CCO[C@@H](c3ccc(Cl)cc3)C2)n1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-10-3-1-9(2-4-10)12-7-18(5-6-20-12)14-17-11(8-21-14)13(16)19/h1-4,8,12H,5-7H2,(H2,16,19)/t12-/m1/s1 |
| InChIKey | HKXHYQKATVFBDV-GFCCVEGCSA-N |
| XLogP | 2.47 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |