C19H19ClFNO3 — CID 95552061
[(2R)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]-(3-fluoro-2-methoxyphenyl)methanone (PubChem CID 95552061) has the molecular formula C19H19ClFNO3 and a molecular weight of 363.82 g/mol. Its IUPAC name is [(2R)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]-(3-fluoro-2-methoxyphenyl)methanone.
| Compound Name | [(2R)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]-(3-fluoro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 95552061 |
| Molecular Formula | C19H19ClFNO3 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [(2R)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]-(3-fluoro-2-methoxyphenyl)methanone |
| SMILES | COc1c(F)cccc1C(=O)N1CCO[C@H](Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C19H19ClFNO3/c1-24-18-15(6-4-8-17(18)21)19(23)22-9-10-25-14(12-22)11-13-5-2-3-7-16(13)20/h2-8,14H,9-12H2,1H3/t14-/m1/s1 |
| InChIKey | JGGCZXNLSYTMOF-CQSZACIVSA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |