C21H24N4O2 — CID 95555587
2-(2-phenoxyethyl)-4-phenyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-one (PubChem CID 95555587) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(2-phenoxyethyl)-4-phenyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-one.
| Compound Name | 2-(2-phenoxyethyl)-4-phenyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 95555587 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-(2-phenoxyethyl)-4-phenyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(CCOc2ccccc2)nc([C@@H]2CCCNC2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4O2/c26-21-24(14-15-27-19-11-5-2-6-12-19)23-20(17-8-7-13-22-16-17)25(21)18-9-3-1-4-10-18/h1-6,9-12,17,22H,7-8,13-16H2/t17-/m1/s1 |
| InChIKey | DIVBIDBXWKYBCM-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |