C14H26N4O2 — CID 95218629
4-ethyl-5-[(3R)-piperidin-3-yl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one (PubChem CID 95218629) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-ethyl-5-[(3R)-piperidin-3-yl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-ethyl-5-[(3R)-piperidin-3-yl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 95218629 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-ethyl-5-[(3R)-piperidin-3-yl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one |
| SMILES | CCCOCCn1nc([C@@H]2CCCNC2)n(CC)c1=O |
| InChI | InChI=1S/C14H26N4O2/c1-3-9-20-10-8-18-14(19)17(4-2)13(16-18)12-6-5-7-15-11-12/h12,15H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | SUZXFPNDOKHDKB-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|