C13H26Cl2N4O2 — CID 171687125
4-ethyl-2-(4-hydroxybutyl)-5-piperidin-3-yl-1,2,4-triazol-3-one;dihydrochloride (PubChem CID 171687125) has the molecular formula C13H26Cl2N4O2 and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-ethyl-2-(4-hydroxybutyl)-5-piperidin-3-yl-1,2,4-triazol-3-one;dihydrochloride.
| Compound Name | 4-ethyl-2-(4-hydroxybutyl)-5-piperidin-3-yl-1,2,4-triazol-3-one;dihydrochloride |
|---|---|
| PubChem CID | 171687125 |
| Molecular Formula | C13H26Cl2N4O2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-ethyl-2-(4-hydroxybutyl)-5-piperidin-3-yl-1,2,4-triazol-3-one;dihydrochloride |
| SMILES | CCn1c(C2CCCNC2)nn(CCCCO)c1=O.Cl.Cl |
| InChI | InChI=1S/C13H24N4O2.2ClH/c1-2-16-12(11-6-5-7-14-10-11)15-17(13(16)19)8-3-4-9-18;;/h11,14,18H,2-10H2,1H3;2*1H |
| InChIKey | DGFFWCRWMJRKTP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|