C19H31N5O2S — CID 95561284
(3S)-N-(2-methoxyethyl)-1-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 95561284) has the molecular formula C19H31N5O2S and a molecular weight of 393.56 g/mol. Its IUPAC name is (3S)-N-(2-methoxyethyl)-1-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxyethyl)-1-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95561284 |
| Molecular Formula | C19H31N5O2S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3S)-N-(2-methoxyethyl)-1-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN(C2CCN(c3ccnc(SC)n3)CC2)C1 |
| InChI | InChI=1S/C19H31N5O2S/c1-26-13-9-20-18(25)15-4-3-10-24(14-15)16-6-11-23(12-7-16)17-5-8-21-19(22-17)27-2/h5,8,15-16H,3-4,6-7,9-14H2,1-2H3,(H,20,25)/t15-/m0/s1 |
| InChIKey | CMYSPPOUIXKHIO-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|