C19H31FN6O2 — CID 56880429
1-[1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 56880429) has the molecular formula C19H31FN6O2 and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-[1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56880429 |
| Molecular Formula | C19H31FN6O2 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-[1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | CNc1nc(N2CCC(N3CCCC(C(=O)NCCOC)C3)CC2)ncc1F |
| InChI | InChI=1S/C19H31FN6O2/c1-21-17-16(20)12-23-19(24-17)25-9-5-15(6-10-25)26-8-3-4-14(13-26)18(27)22-7-11-28-2/h12,14-15H,3-11,13H2,1-2H3,(H,22,27)(H,21,23,24) |
| InChIKey | YRQFUJRSFYSUTB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|