C19H24FN5O — CID 134699717
1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 134699717) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134699717 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | CNc1nc(N2CCC(C(=O)NCCc3ccccc3)CC2)ncc1F |
| InChI | InChI=1S/C19H24FN5O/c1-21-17-16(20)13-23-19(24-17)25-11-8-15(9-12-25)18(26)22-10-7-14-5-3-2-4-6-14/h2-6,13,15H,7-12H2,1H3,(H,22,26)(H,21,23,24) |
| InChIKey | YYAUKIYYMPATRO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |