C19H22N6O — CID 157018162
N-benzyl-1-(9-methylpurin-2-yl)piperidine-4-carboxamide (PubChem CID 157018162) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-benzyl-1-(9-methylpurin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-(9-methylpurin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 157018162 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-benzyl-1-(9-methylpurin-2-yl)piperidine-4-carboxamide |
| SMILES | Cn1cnc2cnc(N3CCC(C(=O)NCc4ccccc4)CC3)nc21 |
| InChI | InChI=1S/C19H22N6O/c1-24-13-22-16-12-21-19(23-17(16)24)25-9-7-15(8-10-25)18(26)20-11-14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3,(H,20,26) |
| InChIKey | RCIIAFKRCVYHNM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |