C15H18ClN3O2 — CID 95563631
(2R)-2-(4-chlorophenyl)-4-(5-propyl-1,2,4-oxadiazol-3-yl)morpholine (PubChem CID 95563631) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-4-(5-propyl-1,2,4-oxadiazol-3-yl)morpholine.
| Compound Name | (2R)-2-(4-chlorophenyl)-4-(5-propyl-1,2,4-oxadiazol-3-yl)morpholine |
|---|---|
| PubChem CID | 95563631 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-4-(5-propyl-1,2,4-oxadiazol-3-yl)morpholine |
| SMILES | CCCc1nc(N2CCO[C@H](c3ccc(Cl)cc3)C2)no1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-2-3-14-17-15(18-21-14)19-8-9-20-13(10-19)11-4-6-12(16)7-5-11/h4-7,13H,2-3,8-10H2,1H3/t13-/m0/s1 |
| InChIKey | XVZKBAMLQPCOHE-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |