C21H20N2O2 — CID 95567469
(2S)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-2-phenylacetamide (PubChem CID 95567469) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-2-phenylacetamide.
| Compound Name | (2S)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 95567469 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2S)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-2-phenylacetamide |
| SMILES | NC(=O)[C@@H](NCc1cc(-c2ccccc2)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c22-21(25)20(16-9-5-2-6-10-16)23-14-18-13-17(11-12-19(18)24)15-7-3-1-4-8-15/h1-13,20,23-24H,14H2,(H2,22,25)/t20-/m0/s1 |
| InChIKey | PPHHKRWBTWXSGY-FQEVSTJZSA-N |
| XLogP | 3.38 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|