C21H24N4O — CID 95569682
2-[[4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]methyl]pyridine (PubChem CID 95569682) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]methyl]pyridine.
| Compound Name | 2-[[4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 95569682 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]methyl]pyridine |
| SMILES | Cn1cc([C@@H]2CCCN2Cc2ccc(OCc3ccccn3)cc2)cn1 |
| InChI | InChI=1S/C21H24N4O/c1-24-15-18(13-23-24)21-6-4-12-25(21)14-17-7-9-20(10-8-17)26-16-19-5-2-3-11-22-19/h2-3,5,7-11,13,15,21H,4,6,12,14,16H2,1H3/t21-/m0/s1 |
| InChIKey | VVKKWEQIXPZZCF-NRFANRHFSA-N |
| XLogP | 3.73 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |