C20H24N6 — CID 124885920
(2R)-2-(1-methylpyrazol-4-yl)-1,4-bis(pyridin-2-ylmethyl)piperazine (PubChem CID 124885920) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2R)-2-(1-methylpyrazol-4-yl)-1,4-bis(pyridin-2-ylmethyl)piperazine.
| Compound Name | (2R)-2-(1-methylpyrazol-4-yl)-1,4-bis(pyridin-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 124885920 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (2R)-2-(1-methylpyrazol-4-yl)-1,4-bis(pyridin-2-ylmethyl)piperazine |
| SMILES | Cn1cc([C@@H]2CN(Cc3ccccn3)CCN2Cc2ccccn2)cn1 |
| InChI | InChI=1S/C20H24N6/c1-24-13-17(12-23-24)20-16-25(14-18-6-2-4-8-21-18)10-11-26(20)15-19-7-3-5-9-22-19/h2-9,12-13,20H,10-11,14-16H2,1H3/t20-/m0/s1 |
| InChIKey | UIUWSTINKBDAIV-FQEVSTJZSA-N |
| XLogP | 2.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |