C39H47N9 — CID 118551578
4-[[1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]aniline (PubChem CID 118551578) has the molecular formula C39H47N9 and a molecular weight of 641.87 g/mol. Its IUPAC name is 4-[[1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]aniline.
| Compound Name | 4-[[1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 118551578 |
| Molecular Formula | C39H47N9 |
| Molecular Weight | 641.87 g/mol |
| Exact Mass | 641.40 |
| IUPAC Name | 4-[[1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]aniline |
| SMILES | Nc1ccc(CC2CN(Cc3ccccn3)CCN(Cc3ccccn3)CCN(Cc3ccccn3)CCN2Cc2ccccn2)cc1 |
| InChI | InChI=1S/C39H47N9/c40-34-15-13-33(14-16-34)27-39-32-47(30-37-11-3-7-19-43-37)24-23-45(28-35-9-1-5-17-41-35)21-22-46(29-36-10-2-6-18-42-36)25-26-48(39)31-38-12-4-8-20-44-38/h1-20,39H,21-32,40H2 |
| InChIKey | SQPDDJMFIOVTRJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|