C11H14ClN5S — CID 95569838
5-chloro-4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]thiadiazole (PubChem CID 95569838) has the molecular formula C11H14ClN5S and a molecular weight of 283.79 g/mol. Its IUPAC name is 5-chloro-4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]thiadiazole.
| Compound Name | 5-chloro-4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]thiadiazole |
|---|---|
| PubChem CID | 95569838 |
| Molecular Formula | C11H14ClN5S |
| Molecular Weight | 283.79 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-chloro-4-[[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]thiadiazole |
| SMILES | Cn1cc([C@@H]2CCCN2Cc2nnsc2Cl)cn1 |
| InChI | InChI=1S/C11H14ClN5S/c1-16-6-8(5-13-16)10-3-2-4-17(10)7-9-11(12)18-15-14-9/h5-6,10H,2-4,7H2,1H3/t10-/m0/s1 |
| InChIKey | RHCPTQCFTWMDJX-JTQLQIEISA-N |
| XLogP | 2.26 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |