C15H28N4OS — CID 95573145
1-[(2R)-butan-2-yl]-3-(3-ethoxypropyl)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 95573145) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(3-ethoxypropyl)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(3-ethoxypropyl)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 95573145 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(3-ethoxypropyl)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1csc(C)n1)N[C@H](C)CC |
| InChI | InChI=1S/C15H28N4OS/c1-5-12(3)18-15(16-8-7-9-20-6-2)17-10-14-11-21-13(4)19-14/h11-12H,5-10H2,1-4H3,(H2,16,17,18)/t12-/m1/s1 |
| InChIKey | APSGCZCFGKWBFB-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|