C17H20N4O2 — CID 95580405
[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone (PubChem CID 95580405) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone.
| Compound Name | [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 95580405 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone |
| SMILES | O=C(c1ccnc(-n2ccnc2)c1)N1CCO[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H20N4O2/c22-17(21-9-10-23-15-4-2-1-3-14(15)21)13-5-6-19-16(11-13)20-8-7-18-12-20/h5-8,11-12,14-15H,1-4,9-10H2/t14-,15+/m1/s1 |
| InChIKey | LHFXGYYCUGGAAM-CABCVRRESA-N |
| XLogP | 2.05 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |