C17H18N6O — CID 95281721
(2-imidazol-1-yl-4-pyridinyl)-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]methanone (PubChem CID 95281721) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is (2-imidazol-1-yl-4-pyridinyl)-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]methanone.
| Compound Name | (2-imidazol-1-yl-4-pyridinyl)-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95281721 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2-imidazol-1-yl-4-pyridinyl)-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(-n2ccnc2)c1)N1CCC[C@H](n2cccn2)C1 |
| InChI | InChI=1S/C17H18N6O/c24-17(14-4-6-19-16(11-14)22-10-7-18-13-22)21-8-1-3-15(12-21)23-9-2-5-20-23/h2,4-7,9-11,13,15H,1,3,8,12H2/t15-/m0/s1 |
| InChIKey | IBDAZJYIGGHLDG-HNNXBMFYSA-N |
| XLogP | 1.94 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |