C25H28N4O3 — CID 95581974
N-benzyl-3-(3-imidazol-1-ylpropanoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 95581974) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-benzyl-3-(3-imidazol-1-ylpropanoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | N-benzyl-3-(3-imidazol-1-ylpropanoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95581974 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-benzyl-3-(3-imidazol-1-ylpropanoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(CCn1ccnc1)Nc1cccc(C(=O)N(Cc2ccccc2)C[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C25H28N4O3/c30-24(11-13-28-14-12-26-19-28)27-22-9-4-8-21(16-22)25(31)29(18-23-10-5-15-32-23)17-20-6-2-1-3-7-20/h1-4,6-9,12,14,16,19,23H,5,10-11,13,15,17-18H2,(H,27,30)/t23-/m1/s1 |
| InChIKey | KAKGVDSCROLGRD-HSZRJFAPSA-N |
| XLogP | 3.73 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |