C17H25N3O3 — CID 95584791
2-[4-[(2R)-2-ethoxy-2-phenylacetyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 95584791) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[4-[(2R)-2-ethoxy-2-phenylacetyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-[(2R)-2-ethoxy-2-phenylacetyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 95584791 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[4-[(2R)-2-ethoxy-2-phenylacetyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CCO[C@@H](C(=O)N1CCCN(CC(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-23-16(14-7-4-3-5-8-14)17(22)20-10-6-9-19(11-12-20)13-15(18)21/h3-5,7-8,16H,2,6,9-13H2,1H3,(H2,18,21)/t16-/m1/s1 |
| InChIKey | RJPUXJQTWGGYIM-MRXNPFEDSA-N |
| XLogP | 0.78 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |