C23H27NO2 — CID 95587854
[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-(3-phenylcyclobutyl)methanone (PubChem CID 95587854) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-(3-phenylcyclobutyl)methanone.
| Compound Name | [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-(3-phenylcyclobutyl)methanone |
|---|---|
| PubChem CID | 95587854 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-(3-phenylcyclobutyl)methanone |
| SMILES | O=C(C1CC(c2ccccc2)C1)N1CCC([C@@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27NO2/c25-22(18-9-5-2-6-10-18)19-11-13-24(14-12-19)23(26)21-15-20(16-21)17-7-3-1-4-8-17/h1-10,19-22,25H,11-16H2/t20?,21?,22-/m0/s1 |
| InChIKey | USXCRHJTGVQJKL-HRTMPFAESA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |