C16H20N2O4 — CID 100856645
[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-[(1R,2R)-2-nitrocyclopropyl]methanone (PubChem CID 100856645) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-[(1R,2R)-2-nitrocyclopropyl]methanone.
| Compound Name | [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-[(1R,2R)-2-nitrocyclopropyl]methanone |
|---|---|
| PubChem CID | 100856645 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]-[(1R,2R)-2-nitrocyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@H]1[N+](=O)[O-])N1CCC([C@@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N2O4/c19-15(11-4-2-1-3-5-11)12-6-8-17(9-7-12)16(20)13-10-14(13)18(21)22/h1-5,12-15,19H,6-10H2/t13-,14-,15+/m1/s1 |
| InChIKey | GYJQTSBVQZWZCD-KFWWJZLASA-N |
| XLogP | 1.62 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|