C15H21N3O3 — CID 71934432
[4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-(2-nitrocyclopropyl)methanone (PubChem CID 71934432) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-(2-nitrocyclopropyl)methanone.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-(2-nitrocyclopropyl)methanone |
|---|---|
| PubChem CID | 71934432 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-(2-nitrocyclopropyl)methanone |
| SMILES | Cc1ccc(C)n1C1CCN(C(=O)C2CC2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-10-3-4-11(2)17(10)12-5-7-16(8-6-12)15(19)13-9-14(13)18(20)21/h3-4,12-14H,5-9H2,1-2H3 |
| InChIKey | NYGUGGAEYFMVJZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|