C17H20N2O2S — CID 95592424
ethyl 6-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]amino]pyridine-3-carboxylate (PubChem CID 95592424) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is ethyl 6-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 95592424 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 6-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N[C@@H](C)c2ccc(SC)cc2)nc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-4-21-17(20)14-7-10-16(18-11-14)19-12(2)13-5-8-15(22-3)9-6-13/h5-12H,4H2,1-3H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | YDJLFRIGLJWOJQ-LBPRGKRZSA-N |
| XLogP | 4.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |