C17H20N2O2 — CID 115578365
ethyl 6-(2-phenylpropylamino)pyridine-3-carboxylate (PubChem CID 115578365) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 6-(2-phenylpropylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(2-phenylpropylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 115578365 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 6-(2-phenylpropylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCC(C)c2ccccc2)nc1 |
| InChI | InChI=1S/C17H20N2O2/c1-3-21-17(20)15-9-10-16(19-12-15)18-11-13(2)14-7-5-4-6-8-14/h4-10,12-13H,3,11H2,1-2H3,(H,18,19) |
| InChIKey | LURUDAMIZFOXDL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |