C18H22ClN3O2 — CID 31536134
ethyl 6-[[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]pyridine-3-carboxylate (PubChem CID 31536134) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is ethyl 6-[[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 31536134 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | ethyl 6-[[(2S)-2-(2-chlorophenyl)-2-(dimethylamino)ethyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC[C@H](c2ccccc2Cl)N(C)C)nc1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-4-24-18(23)13-9-10-17(20-11-13)21-12-16(22(2)3)14-7-5-6-8-15(14)19/h5-11,16H,4,12H2,1-3H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | BZZQNACGSSIUFS-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |