C15H22ClNO3S — CID 95599438
2-[(R)-(3-chlorophenyl)methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 95599438) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 2-[(R)-(3-chlorophenyl)methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[(R)-(3-chlorophenyl)methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 95599438 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[(R)-(3-chlorophenyl)methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)C[S@](=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-12(2)20-8-4-7-17-15(18)11-21(19)10-13-5-3-6-14(16)9-13/h3,5-6,9,12H,4,7-8,10-11H2,1-2H3,(H,17,18)/t21-/m1/s1 |
| InChIKey | RALBJOBQUNVFOE-OAQYLSRUSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|