C19H25FN2O4S — CID 20860400
2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 20860400) has the molecular formula C19H25FN2O4S and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 20860400 |
| Molecular Formula | C19H25FN2O4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | Cc1oc(-c2ccccc2F)nc1CS(=O)CC(=O)NCCCOC(C)C |
| InChI | InChI=1S/C19H25FN2O4S/c1-13(2)25-10-6-9-21-18(23)12-27(24)11-17-14(3)26-19(22-17)15-7-4-5-8-16(15)20/h4-5,7-8,13H,6,9-12H2,1-3H3,(H,21,23) |
| InChIKey | ZYMNXGSPNOVYKP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|