C19H22N4O — CID 95600366
[3-(methylamino)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone (PubChem CID 95600366) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is [3-(methylamino)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone.
| Compound Name | [3-(methylamino)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 95600366 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | [3-(methylamino)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
| SMILES | CNc1cc2c(nn1)CCN(C(=O)[C@H]1CCCc3ccccc31)C2 |
| InChI | InChI=1S/C19H22N4O/c1-20-18-11-14-12-23(10-9-17(14)21-22-18)19(24)16-8-4-6-13-5-2-3-7-15(13)16/h2-3,5,7,11,16H,4,6,8-10,12H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | RGNGSXAOPZHEEG-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |