C18H26N2O3 — CID 95601607
(2R)-2-cyclopentyloxy-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-phenylacetamide (PubChem CID 95601607) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R)-2-cyclopentyloxy-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-cyclopentyloxy-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 95601607 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2R)-2-cyclopentyloxy-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)[C@H](OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-19(2)16(21)13-20(3)18(22)17(14-9-5-4-6-10-14)23-15-11-7-8-12-15/h4-6,9-10,15,17H,7-8,11-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | KWPOUDCMBCSOIR-QGZVFWFLSA-N |
| XLogP | 2.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |