C15H25N5O2 — CID 95603907
[(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]hexan-2-yl]urea (PubChem CID 95603907) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]hexan-2-yl]urea.
| Compound Name | [(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]hexan-2-yl]urea |
|---|---|
| PubChem CID | 95603907 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [(2S)-1-oxo-1-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]hexan-2-yl]urea |
| SMILES | CCCC[C@H](NC(N)=O)C(=O)N1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C15H25N5O2/c1-2-3-7-13(18-15(16)22)14(21)20-10-4-6-12(20)11-19-9-5-8-17-19/h5,8-9,12-13H,2-4,6-7,10-11H2,1H3,(H3,16,18,22)/t12-,13-/m0/s1 |
| InChIKey | GMHAGWPICYVFNK-STQMWFEESA-N |
| XLogP | 1.10 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |