C13H27ClN4O2 — CID 119649300
[1-[2-(methylaminomethyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]urea;hydrochloride (PubChem CID 119649300) has the molecular formula C13H27ClN4O2 and a molecular weight of 306.84 g/mol. Its IUPAC name is [1-[2-(methylaminomethyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]urea;hydrochloride.
| Compound Name | [1-[2-(methylaminomethyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 119649300 |
| Molecular Formula | C13H27ClN4O2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [1-[2-(methylaminomethyl)pyrrolidin-1-yl]-1-oxohexan-2-yl]urea;hydrochloride |
| SMILES | CCCCC(NC(N)=O)C(=O)N1CCCC1CNC.Cl |
| InChI | InChI=1S/C13H26N4O2.ClH/c1-3-4-7-11(16-13(14)19)12(18)17-8-5-6-10(17)9-15-2;/h10-11,15H,3-9H2,1-2H3,(H3,14,16,19);1H |
| InChIKey | YWKADAMSACNECB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |