C13H26N4O2 — CID 124725714
[(2S)-1-[(2R)-2,4-dimethylpiperazin-1-yl]-1-oxohexan-2-yl]urea (PubChem CID 124725714) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2,4-dimethylpiperazin-1-yl]-1-oxohexan-2-yl]urea.
| Compound Name | [(2S)-1-[(2R)-2,4-dimethylpiperazin-1-yl]-1-oxohexan-2-yl]urea |
|---|---|
| PubChem CID | 124725714 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | [(2S)-1-[(2R)-2,4-dimethylpiperazin-1-yl]-1-oxohexan-2-yl]urea |
| SMILES | CCCC[C@H](NC(N)=O)C(=O)N1CCN(C)C[C@H]1C |
| InChI | InChI=1S/C13H26N4O2/c1-4-5-6-11(15-13(14)19)12(18)17-8-7-16(3)9-10(17)2/h10-11H,4-9H2,1-3H3,(H3,14,15,19)/t10-,11+/m1/s1 |
| InChIKey | BKXQIFXVQUBXDU-MNOVXSKESA-N |
| XLogP | 0.38 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |