C13H26N4O2 — CID 119475285
N-(4-aminocyclohexyl)-2-(carbamoylamino)hexanamide (PubChem CID 119475285) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(carbamoylamino)hexanamide.
| Compound Name | N-(4-aminocyclohexyl)-2-(carbamoylamino)hexanamide |
|---|---|
| PubChem CID | 119475285 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(carbamoylamino)hexanamide |
| SMILES | CCCCC(NC(N)=O)C(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C13H26N4O2/c1-2-3-4-11(17-13(15)19)12(18)16-10-7-5-9(14)6-8-10/h9-11H,2-8,14H2,1H3,(H,16,18)(H3,15,17,19) |
| InChIKey | MVXPEZPDUOFNNV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |