C16H33ClN4O2 — CID 119619625
2-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]hexanamide;hydrochloride (PubChem CID 119619625) has the molecular formula C16H33ClN4O2 and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]hexanamide;hydrochloride.
| Compound Name | 2-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 119619625 |
| Molecular Formula | C16H33ClN4O2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]hexanamide;hydrochloride |
| SMILES | CCCCC(NC(N)=O)C(=O)NCCNC1CCCCCC1.Cl |
| InChI | InChI=1S/C16H32N4O2.ClH/c1-2-3-10-14(20-16(17)22)15(21)19-12-11-18-13-8-6-4-5-7-9-13;/h13-14,18H,2-12H2,1H3,(H,19,21)(H3,17,20,22);1H |
| InChIKey | JLGLAMFAUQYZLY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|