C18H25N5O — CID 95606570
[6-(dimethylamino)-3-pyridinyl]-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]methanone (PubChem CID 95606570) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is [6-(dimethylamino)-3-pyridinyl]-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [6-(dimethylamino)-3-pyridinyl]-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95606570 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | [6-(dimethylamino)-3-pyridinyl]-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]methanone |
| SMILES | CCc1nccn1[C@@H]1CCCN(C(=O)c2ccc(N(C)C)nc2)C1 |
| InChI | InChI=1S/C18H25N5O/c1-4-16-19-9-11-23(16)15-6-5-10-22(13-15)18(24)14-7-8-17(20-12-14)21(2)3/h7-9,11-12,15H,4-6,10,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | FQZDANBUCWAFLE-OAHLLOKOSA-N |
| XLogP | 2.38 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |