C17H21ClN4O2 — CID 95607033
[3-(3-chlorophenyl)-1H-pyrazol-5-yl]-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95607033) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is [3-(3-chlorophenyl)-1H-pyrazol-5-yl]-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone.
| Compound Name | [3-(3-chlorophenyl)-1H-pyrazol-5-yl]-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95607033 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [3-(3-chlorophenyl)-1H-pyrazol-5-yl]-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | C[C@H](O)CN1CCN(C(=O)c2cc(-c3cccc(Cl)c3)n[nH]2)CC1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-12(23)11-21-5-7-22(8-6-21)17(24)16-10-15(19-20-16)13-3-2-4-14(18)9-13/h2-4,9-10,12,23H,5-8,11H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | AWVBGTFYZZRHOH-LBPRGKRZSA-N |
| XLogP | 1.87 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |