C16H20ClN3O2 — CID 95607083
(3-chloro-1H-indol-2-yl)-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95607083) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is (3-chloro-1H-indol-2-yl)-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone.
| Compound Name | (3-chloro-1H-indol-2-yl)-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95607083 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (3-chloro-1H-indol-2-yl)-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | C[C@H](O)CN1CCN(C(=O)c2[nH]c3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-11(21)10-19-6-8-20(9-7-19)16(22)15-14(17)12-4-2-3-5-13(12)18-15/h2-5,11,18,21H,6-10H2,1H3/t11-/m0/s1 |
| InChIKey | DYHXKMOOFWFHJP-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |