C19H25N5O — CID 95607706
(2R)-N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]propanamide (PubChem CID 95607706) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]propanamide.
| Compound Name | (2R)-N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 95607706 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (2R)-N-[2-(1H-indol-3-yl)ethyl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]propanamide |
| SMILES | Cc1cnn(CCN[C@H](C)C(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H25N5O/c1-14-11-23-24(13-14)10-9-20-15(2)19(25)21-8-7-16-12-22-18-6-4-3-5-17(16)18/h3-6,11-13,15,20,22H,7-10H2,1-2H3,(H,21,25)/t15-/m1/s1 |
| InChIKey | UFWNEZWYOLOPTQ-OAHLLOKOSA-N |
| XLogP | 2.01 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |