C20H29N3O2 — CID 95612422
1-[1-(2-methylprop-2-enyl)piperidin-4-yl]-3-[(5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]urea (PubChem CID 95612422) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[1-(2-methylprop-2-enyl)piperidin-4-yl]-3-[(5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]urea.
| Compound Name | 1-[1-(2-methylprop-2-enyl)piperidin-4-yl]-3-[(5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]urea |
|---|---|
| PubChem CID | 95612422 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[1-(2-methylprop-2-enyl)piperidin-4-yl]-3-[(5R)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]urea |
| SMILES | C=C(C)CN1CCC(NC(=O)N[C@@H]2CCCOc3ccccc32)CC1 |
| InChI | InChI=1S/C20H29N3O2/c1-15(2)14-23-11-9-16(10-12-23)21-20(24)22-18-7-5-13-25-19-8-4-3-6-17(18)19/h3-4,6,8,16,18H,1,5,7,9-14H2,2H3,(H2,21,22,24)/t18-/m1/s1 |
| InChIKey | GQGGFQUTDFZKHX-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|