C15H25N5O3 — CID 95614884
tert-butyl N-[(1R)-1-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]ethyl]carbamate (PubChem CID 95614884) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 95614884 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | tert-butyl N-[(1R)-1-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C1CCN(C(=O)c2cn[nH]n2)CC1 |
| InChI | InChI=1S/C15H25N5O3/c1-10(17-14(22)23-15(2,3)4)11-5-7-20(8-6-11)13(21)12-9-16-19-18-12/h9-11H,5-8H2,1-4H3,(H,17,22)(H,16,18,19)/t10-/m1/s1 |
| InChIKey | OJNCWKZZLJHFEY-SNVBAGLBSA-N |
| XLogP | 1.57 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |