C16H19F2N3O2 — CID 95615142
N-[2-[(2R)-butan-2-yl]pyrazol-3-yl]-2-[3-(difluoromethoxy)phenyl]acetamide (PubChem CID 95615142) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is N-[2-[(2R)-butan-2-yl]pyrazol-3-yl]-2-[3-(difluoromethoxy)phenyl]acetamide.
| Compound Name | N-[2-[(2R)-butan-2-yl]pyrazol-3-yl]-2-[3-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 95615142 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-[(2R)-butan-2-yl]pyrazol-3-yl]-2-[3-(difluoromethoxy)phenyl]acetamide |
| SMILES | CC[C@@H](C)n1nccc1NC(=O)Cc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-3-11(2)21-14(7-8-19-21)20-15(22)10-12-5-4-6-13(9-12)23-16(17)18/h4-9,11,16H,3,10H2,1-2H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | FRLQNAQUUFUKRA-LLVKDONJSA-N |
| XLogP | 3.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |