C6H14N8 — CID 9561662
Ethylglyoxal bis(guanylhydrazone) (PubChem CID 9561662) has the molecular formula C6H14N8 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[(E)-[(1E)-1-(diaminomethylidenehydrazinylidene)butan-2-ylidene]amino]guanidine.
| Compound Name | Ethylglyoxal bis(guanylhydrazone) |
|---|---|
| PubChem CID | 9561662 |
| Molecular Formula | C6H14N8 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-[(E)-[(1E)-1-(diaminomethylidenehydrazinylidene)butan-2-ylidene]amino]guanidine |
| SMILES | CC/C(=N\N=C(N)N)/C=N/N=C(N)N |
| InChI | InChI=1S/C6H14N8/c1-2-4(12-14-6(9)10)3-11-13-5(7)8/h3H,2H2,1H3,(H4,7,8,13)(H4,9,10,14)/b11-3+,12-4+ |
| InChIKey | DDNVYHHARMNUBE-HMMKTVFPSA-N |
| XLogP | -1.70 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 278 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|