C5H12N8 — CID 9991
2-[1-(Diaminomethylidenehydrazinylidene)propan-2-ylideneamino]guanidine (PubChem CID 9991) has the molecular formula C5H12N8 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-[1-(diaminomethylidenehydrazinylidene)propan-2-ylideneamino]guanidine.
| Compound Name | 2-[1-(Diaminomethylidenehydrazinylidene)propan-2-ylideneamino]guanidine |
|---|---|
| PubChem CID | 9991 |
| Molecular Formula | C5H12N8 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-[1-(diaminomethylidenehydrazinylidene)propan-2-ylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)C=NN=C(N)N |
| InChI | InChI=1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13) |
| InChIKey | MXWHMTNPTTVWDM-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 264 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|