About [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone
[(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 95619935) has the molecular formula C19H29N3O3
and a molecular weight of 347.46 g/mol. Its IUPAC name is [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone |
| PubChem CID | 95619935 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1c(C)cnc(CN2CCCC[C@@H]2C(=O)N2CCOCC2)c1C |
| InChI | InChI=1S/C19H29N3O3/c1-14-12-20-16(15(2)18(14)24-3)13-22-7-5-4-6-17(22)19(23)21-8-10-25-11-9-21/h12,17H,4-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | YKBLRJVTRNWEBV-QGZVFWFLSA-N |
| XLogP | 1.92 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The IUPAC name of [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone (CID 95619935) is [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone is COc1c(C)cnc(CN2CCCC[C@@H]2C(=O)N2CCOCC2)c1C.
What is the InChIKey of [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
The InChIKey is YKBLRJVTRNWEBV-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H29N3O3/c1-14-12-20-16(15(2)18(14)24-3)13-22-7-5-4-6-17(22)19(23)21-8-10-25-11-9-21/h12,17H,4-11,13H2,1-3H3/t17-/m1/s1.
What are the key properties of [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone?
[(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone has a molecular weight of 347.46 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperidin-2-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 95619935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).