C18H30N4O — CID 95622001
1-[2-[(3S)-3-ethylpiperidin-1-yl]-2-methylpropyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 95622001) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[2-[(3S)-3-ethylpiperidin-1-yl]-2-methylpropyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[2-[(3S)-3-ethylpiperidin-1-yl]-2-methylpropyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 95622001 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 1-[2-[(3S)-3-ethylpiperidin-1-yl]-2-methylpropyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CC[C@H]1CCCN(C(C)(C)CNC(=O)NCc2cccnc2)C1 |
| InChI | InChI=1S/C18H30N4O/c1-4-15-8-6-10-22(13-15)18(2,3)14-21-17(23)20-12-16-7-5-9-19-11-16/h5,7,9,11,15H,4,6,8,10,12-14H2,1-3H3,(H2,20,21,23)/t15-/m0/s1 |
| InChIKey | UBJMKBBQPNQEKR-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |