C14H16N4O5 — CID 95623049
3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-4-nitrobenzamide (PubChem CID 95623049) has the molecular formula C14H16N4O5 and a molecular weight of 320.31 g/mol. Its IUPAC name is 3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-4-nitrobenzamide.
| Compound Name | 3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 95623049 |
| Molecular Formula | C14H16N4O5 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-4-nitrobenzamide |
| SMILES | Cc1noc([C@@H](NC(=O)c2ccc([N+](=O)[O-])c(O)c2)C(C)C)n1 |
| InChI | InChI=1S/C14H16N4O5/c1-7(2)12(14-15-8(3)17-23-14)16-13(20)9-4-5-10(18(21)22)11(19)6-9/h4-7,12,19H,1-3H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | USNFVAAEWYTSRZ-LBPRGKRZSA-N |
| XLogP | 2.12 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|